cas: 66845-42-9 — see every product listed under this CAS number, including other names
Z-D-Lys(Boc)-OH 97% (CAS 66845-42-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A112843-250mg |
| cas | 66845-42-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 281.38 Pln | |
| Ambeed | 25g | 559.50 Pln | |
| Ambeed | 100g | 1688.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A112843 |
(2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid (CAS 66845-42-9) is a chemical compound with the molecular formula C19H28N2O6 and a molecular weight of 380.4 g/mol. IUPAC name: (2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: DYSBKEOCHROEGX-OAHLLOKOSA-N.
| Molecular formula | C19H28N2O6 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (2R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | DYSBKEOCHROEGX-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)