N6-BenzoylAdenosine, 95%, 95%
cas: 4546-55-8 — see every product listed under this CAS number, including other names
N6-BenzoylAdenosine, 95%, 95% (CAS 4546-55-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11487M-5g |
| cas | 4546-55-8 |
| size | 5g |
| availability | 2000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 50g | 146.00 Pln | |
| Chemat | 100g | 232.40 Pln | |
| Chemat | 250g | 477.20 Pln | |
| Chemat | 500g | 950.40 Pln | |
| Chemat | 1kg | 1802.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (CAS 4546-55-8) is a chemical compound with the molecular formula C17H17N5O5 and a molecular weight of 371.3 g/mol. IUPAC name: N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide. InChIKey: NZDWTKFDAUOODA-CNEMSGBDSA-N.
| Molecular formula | C17H17N5O5 |
|---|---|
| Molecular weight | 371.3 g/mol |
| IUPAC name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| InChIKey | NZDWTKFDAUOODA-CNEMSGBDSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O |
Computed by PubChem (NCBI)