Products 4546-55-8
CAS 4546-55-8 appears in our catalog under these names: N6–Benzoyladenosine, N6-Benzoyladenosine, N-Benzoyladenosine, N6-Benzoyladenosine, >96.0%(HPLC)(T), N-BENZOYLADENOSINE, 96%. Offered by: GLPBio, Biosynth, Thermo Scientific (Acros), TCI, Sigma-Aldrich. Available pack sizes: 100g, 50g, 1g, 5g, 250g, 1000g, 500g, 10g.
N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (CAS 4546-55-8) is a chemical compound with the molecular formula C17H17N5O5 and a molecular weight of 371.3 g/mol. IUPAC name: N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide. InChIKey: NZDWTKFDAUOODA-CNEMSGBDSA-N.
| Molecular formula | C17H17N5O5 |
|---|---|
| Molecular weight | 371.3 g/mol |
| IUPAC name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| InChIKey | NZDWTKFDAUOODA-CNEMSGBDSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O |
Computed by PubChem (NCBI)