CAS 2467425-50-7 is the registry number for Thalidomide-O-C4-N3. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(4-azidobutoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2467425-50-7) is a chemical compound with the molecular formula C17H17N5O5 and a molecular weight of 371.3 g/mol. IUPAC name: 5-(4-azidobutoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: RIZSEPDFFFLNIT-UHFFFAOYSA-N.
| Molecular formula | C17H17N5O5 |
|---|---|
| Molecular weight | 371.3 g/mol |
| IUPAC name | 5-(4-azidobutoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | RIZSEPDFFFLNIT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)OCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)