Products 2920389-30-4
CAS 2920389-30-4 appears in our catalog under these names: 4-(4-Azidobutoxy)-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione, 98%, 4-amino-1-methylindolin-2-one, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 50mg, 100mg.
4-(4-azidobutoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2920389-30-4) is a chemical compound with the molecular formula C17H17N5O5 and a molecular weight of 371.3 g/mol. IUPAC name: 4-(4-azidobutoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: IHEWLTFCLOFNAP-UHFFFAOYSA-N.
| Molecular formula | C17H17N5O5 |
|---|---|
| Molecular weight | 371.3 g/mol |
| IUPAC name | 4-(4-azidobutoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | IHEWLTFCLOFNAP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)