Products 14357-08-5
CAS 14357-08-5 appears in our catalog under these names: N6-Ethyladenosine/ 99.98% (existing batch purity), N6-Ethyladenosine, N6-Ethyladenosine, 99.90%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
(2R,3R,4S,5R)-2-[6-(ethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (CAS 14357-08-5) is a chemical compound with the molecular formula C12H17N5O4 and a molecular weight of 295.29 g/mol. IUPAC name: (2R,3R,4S,5R)-2-[6-(ethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: SHXVYOLWYFZWKE-WOUKDFQISA-N.
| Molecular formula | C12H17N5O4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-[6-(ethylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | SHXVYOLWYFZWKE-WOUKDFQISA-N |
| SMILES | CCNC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)