CAS 63954-66-5 appears in our catalog under these names: 2,8-Dimethyladenosine, min. 95 %, 5 mg, 2,8-Dimethyladenosine, 2,8-Dimethyladenosine, 98.68%, 2,8-Dimethyladenosine, min. 95 %, 1 mg, 2,8-Dimethyladenosine, min. 95 %, 2 mg. Offered by: Roth, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 10 mg, 1 mg, 5 mg.
(2R,3R,4S,5R)-2-(6-amino-2,8-dimethylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 63954-66-5) is a chemical compound with the molecular formula C12H17N5O4 and a molecular weight of 295.29 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-amino-2,8-dimethylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: FGMBEEFIKCGALL-WOUKDFQISA-N.
| Molecular formula | C12H17N5O4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-amino-2,8-dimethylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | FGMBEEFIKCGALL-WOUKDFQISA-N |
| SMILES | CC1=NC(=C2C(=N1)N(C(=N2)C)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)