Products 1208315-24-5
CAS 1208315-24-5 appears in our catalog under these names: N6022, N6022/ 98.32% (existing batch purity), N6022 98+%, N6022, 98+%, 98+%, N6022, 99.66%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 500mg.
3-[1-(4-carbamoyl-2-methylphenyl)-5-(4-imidazol-1-ylphenyl)pyrrol-2-yl]propanoic acid (CAS 1208315-24-5) is a chemical compound with the molecular formula C24H22N4O3 and a molecular weight of 414.5 g/mol. IUPAC name: 3-[1-(4-carbamoyl-2-methylphenyl)-5-(4-imidazol-1-ylphenyl)pyrrol-2-yl]propanoic acid. InChIKey: YVPGZQLRPAGKLA-UHFFFAOYSA-N.
| Molecular formula | C24H22N4O3 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | 3-[1-(4-carbamoyl-2-methylphenyl)-5-(4-imidazol-1-ylphenyl)pyrrol-2-yl]propanoic acid |
| InChIKey | YVPGZQLRPAGKLA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)N)N2C(=CC=C2C3=CC=C(C=C3)N4C=CN=C4)CCC(=O)O |
Computed by PubChem (NCBI)