Products 2375281-44-8
CAS 2375281-44-8 appears in our catalog under these names: NF-κΒ activator 2, NF–κβ activator 2, 3-(2-((2-Fluorophenyl)amino)oxazol-5-yl)benzoic acid, 98%, 98%, NF-κΒ activator 2, 99.76%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
3-[2-(2-fluoroanilino)-1,3-oxazol-5-yl]benzoic acid (CAS 2375281-44-8) is a chemical compound with the molecular formula C16H11FN2O3 and a molecular weight of 298.27 g/mol. IUPAC name: 3-[2-(2-fluoroanilino)-1,3-oxazol-5-yl]benzoic acid. InChIKey: VGJMPWREFUKMAD-UHFFFAOYSA-N.
| Molecular formula | C16H11FN2O3 |
|---|---|
| Molecular weight | 298.27 g/mol |
| IUPAC name | 3-[2-(2-fluoroanilino)-1,3-oxazol-5-yl]benzoic acid |
| InChIKey | VGJMPWREFUKMAD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=NC=C(O2)C3=CC(=CC=C3)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
NF-kappaBeta activator 2, NF-|E| cent activator 2, 3-(2-((2-Fluorophenyl)amino)oxazol-5-yl)benzoic acid, NF-ts activator 2, 3-[2-(2-fluoroanilino)-1,3-oxazol-5-yl]benzoic acid, 3-{2-[(2-fluorophenyl)amino]-1,3-oxazol-5-yl}benzoic acid, 3-[2-[(2-fluorophenyl)amino]-1,3-oxazol-5-yl]benzoic acid, NF-kB activator 2, NF-?B activator 2, NF-???? activator 2