Products 2411640-10-1
CAS 2411640-10-1 is the registry number for methyl 5-fluoro-4-oxo-3-phenyl-3,4-dihydroquinazoline-2-carboxylate. Offered by: Chemat. Available pack sizes: 1g.
Methyl 5-fluoro-4-oxo-3-phenylquinazoline-2-carboxylate (CAS 2411640-10-1) is a chemical compound with the molecular formula C16H11FN2O3 and a molecular weight of 298.27 g/mol. IUPAC name: methyl 5-fluoro-4-oxo-3-phenylquinazoline-2-carboxylate. InChIKey: XPGIJSMDQUUYKQ-UHFFFAOYSA-N.
| Molecular formula | C16H11FN2O3 |
|---|---|
| Molecular weight | 298.27 g/mol |
| IUPAC name | methyl 5-fluoro-4-oxo-3-phenylquinazoline-2-carboxylate |
| InChIKey | XPGIJSMDQUUYKQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(C(=CC=C2)F)C(=O)N1C3=CC=CC=C3 |
Computed by PubChem (NCBI)