Products 1905453-18-0
CAS 1905453-18-0 appears in our catalog under these names: NSC232003/ 97.72% (existing batch purity), NSC232003, 5-(1-(Hydroxyamino)ethylidene)pyrimidine-2,4(3H,5H)-dione, 98%, 98%, NSC232003, 99.94%, 5-[1-(hydroxyimino)ethyl]-1,2,3,4-tetrahydropyrimidine-2,4-dione, 98%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml water), 10mM/1mL.
5-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1H-pyrimidine-2,4-dione (CAS 1905453-18-0) is a chemical compound with the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. IUPAC name: 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1H-pyrimidine-2,4-dione. InChIKey: UDHCVAJUUVCYHW-YCRREMRBSA-N.
| Molecular formula | C6H7N3O3 |
|---|---|
| Molecular weight | 169.14 g/mol |
| IUPAC name | 5-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1H-pyrimidine-2,4-dione |
| InChIKey | UDHCVAJUUVCYHW-YCRREMRBSA-N |
| SMILES | C/C(=N\O)/C1=CNC(=O)NC1=O |
Computed by PubChem (NCBI)