CAS 64212-22-2 appears in our catalog under these names: 2-(1H-imidazol-1-yl)-1-(naphthalen-2-yl)ethan-1-one, Nafimidone/ 99.87% (existing batch purity), Nafimidone. Offered by: Chemat, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
2-imidazol-1-yl-1-naphthalen-2-ylethanone (CAS 64212-22-2) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 2-imidazol-1-yl-1-naphthalen-2-ylethanone. InChIKey: ITPVLJQRUQVNSD-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 2-imidazol-1-yl-1-naphthalen-2-ylethanone |
| InChIKey | ITPVLJQRUQVNSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)CN3C=CN=C3 |
Computed by PubChem (NCBI)