cas: 38302-15-7 — see every product listed under this CAS number, including other names
Naringenin trimethyl ether (CAS 38302-15-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg. Offered by: TargetMol, Biosynth.
| brand | TargetMol |
|---|---|
| catalog number | T2S2169-1mg |
| cas | 38302-15-7 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 392.86 Pln | |
| TargetMol | 2mg | 518.63 Pln | |
| TargetMol | 5mg | 817.70 Pln | |
| TargetMol | 10mg | 1282.22 Pln | |
| TargetMol | 25mg | 2012.84 Pln | |
| TargetMol | 50mg | 2922.89 Pln | |
| Biosynth | 5mg | price on request |
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
5,7-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one (CAS 38302-15-7) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: 5,7-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: MQFSCAHSIUPLSB-UHFFFAOYSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 5,7-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | MQFSCAHSIUPLSB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CC(=O)C3=C(O2)C=C(C=C3OC)OC |
Computed by PubChem (NCBI)