Norisoboldine, 99%, 99%
cas: 23599-69-1 — see every product listed under this CAS number, including other names
Norisoboldine, 99%, 99% (CAS 23599-69-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113NU3-1mg |
| cas | 23599-69-1 |
| size | 1mg |
| availability | 0.15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 141.20 Pln | |
| Chemat | 5mg | 261.20 Pln | |
| Chemat | 10mg | 347.60 Pln | |
| Chemat | 25mg | 501.20 Pln | |
| Chemat | 50mg | 592.40 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(6aS)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol (CAS 23599-69-1) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: (6aS)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol. InChIKey: HORZNQYQXBFWNZ-LBPRGKRZSA-N.
| Molecular formula | C18H19NO4 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | (6aS)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol |
| InChIKey | HORZNQYQXBFWNZ-LBPRGKRZSA-N |
| SMILES | COC1=C(C2=C3[C@H](CC4=CC(=C(C=C42)OC)O)NCCC3=C1)O |
Computed by PubChem (NCBI)
Synonyms:
NORISOBOLDINE, (+)-Norisoboldine, Norisoboldine, (+)-, (6aS)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol, (6aS)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo(de,g)quinoline-1,9-diol, (+)-Laurelliptine, 4H-Dibenzo[de,g]quinoline-1,9-diol, 5,6,6a,7-tetrahydro-2,10-dimethoxy-, (6aS)-, (S)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol, (+)-N-Norisoboldine, 1,9-dihydroxy-2,10-dimethoxynoraporphine