CAS 26250-86-2 appears in our catalog under these names: (S)-3-(((Benzyloxy)carbonyl)amino)-4-phenylbutanoic acid, 97%, (S)–3–(((Benzyloxy)carbonyl)amino)–4–phenylbutanoic acid, (S)-3-(((Benzyloxy)carbonyl)amino)-4-phenylbutanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g.
(3S)-4-phenyl-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 26250-86-2) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: (3S)-4-phenyl-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: WUIQVOMIYLNNEC-INIZCTEOSA-N.
| Molecular formula | C18H19NO4 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | (3S)-4-phenyl-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | WUIQVOMIYLNNEC-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CC(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)