CAS 1357302-64-7 appears in our catalog under these names: OG-L002/ 97.05% (existing batch purity), OG–L002, OG-L002 98%, 4'-((1R,2S)-2-Aminocyclopropyl)-[1,1'-biphenyl]-3-ol, 98%, 98%, OG-L002, 99.55%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol (CAS 1357302-64-7) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol. InChIKey: DSOJSZXQRJGBCW-CABCVRRESA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | 3-[4-[(1R,2S)-2-aminocyclopropyl]phenyl]phenol |
| InChIKey | DSOJSZXQRJGBCW-CABCVRRESA-N |
| SMILES | C1[C@@H]([C@H]1N)C2=CC=C(C=C2)C3=CC(=CC=C3)O |
Computed by PubChem (NCBI)