Oseltamivir acid 98%
cas: 187227-45-8 — see every product listed under this CAS number, including other names
Oseltamivir acid 98% (CAS 187227-45-8) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A850094-5mg |
| cas | 187227-45-8 |
| size | 5mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 398.19 Pln | |
| Ambeed | 10mg | 626.25 Pln | |
| Ambeed | 25mg | 943.31 Pln | |
| Ambeed | 50mg | 1471.75 Pln | |
| Ambeed | 100mg | 1911.19 Pln | |
| Ambeed | 250mg | 2717.75 Pln | |
| Ambeed | 1g | 5387.75 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A850094 |
Oseltamivir acid is a cyclohexenecarboxylic acid that is cyclohex-1-ene-1-carboxylic acid which is substituted at positions 3, 4, and 5 by pentan-3-yloxy, acetamido, and amino groups, respectively (the 3R,4R,5S enantiomer). An antiviral drug, it is used as the corresponding ethyl ester prodrug, oseltamivir, to slow the spread of influenza. It has a role as an antiviral drug, an EC 3.2.1.18 (exo-alpha-sialidase) inhibitor and a marine xenobiotic metabolite. It is a cyclohexenecarboxylic acid, an amino acid, an acetate ester and a primary amino compound.
Source: ChEBI
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| InChIKey | NENPYTRHICXVCS-YNEHKIRRSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1NC(=O)C)N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Oseltamivir acid, Ro 64-0802, Oseltamivir free acid, Ro-64-0802, Oseltamivir acid, (-)-, Oseltamivir carboxylate, Oseltamivir-carboxylate, (3R,4R,5S)-4-acetamido-5-amino-3-pentan-3-yloxycyclohexene-1-carboxylic acid, (3R,4R,5S)-4-acetamido-5-amino-3-(pentan-3-yloxy)cyclohex-1-enecarboxylic acid, Oseltamivir EP Impurity C