CAS 65854-78-6 appears in our catalog under these names: Oxazepam-d5, >95% (HPLC), Oxazepam-d5 (1mg/ml in Acetonitrile), (±)-Oxazepam-d5 (phenyl-d5), 98 atom % D, min 98% Chemical Purity, Oxazepam-D5, Oxazepam-D5 0.1 mg/ml in Methanol. Offered by: TRC, CDN, Lipomed, LoGiCal, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 1x1ml, 0,01g, 50mg, 100mg, 1ml.
7-chloro-3-hydroxy-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 65854-78-6) is a chemical compound with the molecular formula C15H11ClN2O2 and a molecular weight of 291.74 g/mol. IUPAC name: 7-chloro-3-hydroxy-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: ADIMAYPTOBDMTL-RALIUCGRSA-N.
| Molecular formula | C15H11ClN2O2 |
|---|---|
| Molecular weight | 291.74 g/mol |
| IUPAC name | 7-chloro-3-hydroxy-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | ADIMAYPTOBDMTL-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=NC(C(=O)NC3=C2C=C(C=C3)Cl)O)[2H])[2H] |
Computed by PubChem (NCBI)