Products 158505-66-9

CAS 158505-66-9 is the registry number for Oxiran-2-ylmethyl 4-nitrobenzenesulfonate, 95.64%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 25 mg.

Structural formula: {0} (CAS {1})

Oxiran-2-ylmethyl 4-nitrobenzenesulfonate (CAS 158505-66-9) is a chemical compound with the molecular formula C9H9NO6S and a molecular weight of 259.24 g/mol. IUPAC name: oxiran-2-ylmethyl 4-nitrobenzenesulfonate. InChIKey: CXYDYDCHYJXOEY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO6S
Molecular weight259.24 g/mol
IUPAC nameoxiran-2-ylmethyl 4-nitrobenzenesulfonate
InChIKeyCXYDYDCHYJXOEY-UHFFFAOYSA-N
SMILESC1C(O1)COS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-]

Computed by PubChem (NCBI)