CAS 115314-17-5 appears in our catalog under these names: (R)-(-)-Glycidyl Nosylate, (R)–Glycidyl 3–Nitrobenzenesulfonate, (R)-(-)-Glycidyl nosylate, 98%, (R)-Glycidyl 3-Nitrobenzenesulfonate, >98.0%(GC), (R)-(-)-Glycidyl Nosylate 97%. Offered by: TRC, GLPBio, Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 25g, 5g, 100g, 10g, 2.5g, 50g, 250g, 1g.
[(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate (CAS 115314-17-5) is a chemical compound with the molecular formula C9H9NO6S and a molecular weight of 259.24 g/mol. IUPAC name: [(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate. InChIKey: AIHIHVZYAAMDPM-MRVPVSSYSA-N.
| Molecular formula | C9H9NO6S |
|---|---|
| Molecular weight | 259.24 g/mol |
| IUPAC name | [(2R)-oxiran-2-yl]methyl 3-nitrobenzenesulfonate |
| InChIKey | AIHIHVZYAAMDPM-MRVPVSSYSA-N |
| SMILES | C1[C@@H](O1)COS(=O)(=O)C2=CC=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)