CAS 123750-60-7 appears in our catalog under these names: Glycidyl (R)–(–)–4–nitrobenzenesulfonate, Benzenesulfonic acid, 4-nitro-, (2R)-2-oxiranylmethyl ester, 98%, 98%, GLYCIDYL (R)-(-)-4-NITROBENZENESULFONATE, ≥97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
[(2R)-oxiran-2-yl]methyl 4-nitrobenzenesulfonate (CAS 123750-60-7) is a chemical compound with the molecular formula C9H9NO6S and a molecular weight of 259.24 g/mol. IUPAC name: [(2R)-oxiran-2-yl]methyl 4-nitrobenzenesulfonate. InChIKey: CXYDYDCHYJXOEY-MRVPVSSYSA-N.
| Molecular formula | C9H9NO6S |
|---|---|
| Molecular weight | 259.24 g/mol |
| IUPAC name | [(2R)-oxiran-2-yl]methyl 4-nitrobenzenesulfonate |
| InChIKey | CXYDYDCHYJXOEY-MRVPVSSYSA-N |
| SMILES | C1[C@@H](O1)COS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)