Products 90729-41-2
CAS 90729-41-2 appears in our catalog under these names: Oxodipine/ 99.22% (existing batch purity), Oxodipine. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg.
5-O-ethyl 3-O-methyl 4-(1,3-benzodioxol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 90729-41-2) is a chemical compound with the molecular formula C19H21NO6 and a molecular weight of 359.4 g/mol. IUPAC name: 5-O-ethyl 3-O-methyl 4-(1,3-benzodioxol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: MSOAVHHAZCMHDI-UHFFFAOYSA-N.
| Molecular formula | C19H21NO6 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 5-O-ethyl 3-O-methyl 4-(1,3-benzodioxol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | MSOAVHHAZCMHDI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=C3C(=CC=C2)OCO3)C(=O)OC)C)C |
Computed by PubChem (NCBI)