PAQUINIMOD, 97%
cas: 248282-01-1 — see every product listed under this CAS number, including other names
PAQUINIMOD, 97% (CAS 248282-01-1) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F826326-5MG |
| cas | 248282-01-1 |
| size | 5mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5mg | 492.55 Pln | |
| Fluorochem | 25mg | 1138.16 Pln | |
| Fluorochem | 50mg | 1762.94 Pln | |
| Fluorochem | 100mg | 2767.79 Pln | |
| Fluorochem | 250mg | 4610.89 Pln | |
| Ambeed | 100mg | 2295.00 Pln | |
| Ambeed | 250mg | 4030.50 Pln | |
| Ambeed | 1g | 9965.69 Pln | |
| Chemat | 5mg | 304.40 Pln | |
| Chemat | 25mg | 683.60 Pln | |
| Chemat | 50mg | 1058.00 Pln | |
| Chemat | 100mg | 1653.20 Pln | |
| Chemat | 250mg | 2766.80 Pln | |
| Chemat | 1g | 9434.00 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
N,5-diethyl-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide (CAS 248282-01-1) is a chemical compound with the molecular formula C21H22N2O3 and a molecular weight of 350.4 g/mol. IUPAC name: N,5-diethyl-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide. InChIKey: DIKSYHCCYVYKRO-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O3 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | N,5-diethyl-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
| InChIKey | DIKSYHCCYVYKRO-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)N(C(=O)C(=C2O)C(=O)N(CC)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)