CAS 834913-12-1 appears in our catalog under these names: 5-((4-(tert-Butyl)phenoxy)methyl)-N-(pyridin-3-yl)furan-2-carboxamide, ≥95%, ≥95%, 5-((4-(tert-Butyl)phenoxy)methyl)-N-(pyridin-3-yl)furan-2-carboxamide, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1mg, 5mg, 100mg, 250mg, 1g.
5-[(4-tert-butylphenoxy)methyl]-N-pyridin-3-ylfuran-2-carboxamide (CAS 834913-12-1) is a chemical compound with the molecular formula C21H22N2O3 and a molecular weight of 350.4 g/mol. IUPAC name: 5-[(4-tert-butylphenoxy)methyl]-N-pyridin-3-ylfuran-2-carboxamide. InChIKey: ADDHTLSQUNSMNN-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O3 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 5-[(4-tert-butylphenoxy)methyl]-N-pyridin-3-ylfuran-2-carboxamide |
| InChIKey | ADDHTLSQUNSMNN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OCC2=CC=C(O2)C(=O)NC3=CN=CC=C3 |
Computed by PubChem (NCBI)