CAS 248282-01-1 appears in our catalog under these names: Paquinimod/ 99.61% (existing batch purity), Paquinimod (ABR 25757), Paquinimod, Paquinimod - Bio-X â„¢, Paquinimod, 97%, 97%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
N,5-diethyl-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide (CAS 248282-01-1) is a chemical compound with the molecular formula C21H22N2O3 and a molecular weight of 350.4 g/mol. IUPAC name: N,5-diethyl-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide. InChIKey: DIKSYHCCYVYKRO-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O3 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | N,5-diethyl-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
| InChIKey | DIKSYHCCYVYKRO-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)N(C(=O)C(=C2O)C(=O)N(CC)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)