CAS 149620-85-9 is the registry number for 1,1–Dimethylethyl 2,3–dihydro–2–oxo–5–phenyl–1H–1,4–benzodiazepine–1–acetate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
Tert-butyl 2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)acetate (CAS 149620-85-9) is a chemical compound with the molecular formula C21H22N2O3 and a molecular weight of 350.4 g/mol. IUPAC name: tert-butyl 2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)acetate. InChIKey: HUODWEBWPBHFEO-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O3 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | tert-butyl 2-(2-oxo-5-phenyl-3H-1,4-benzodiazepin-1-yl)acetate |
| InChIKey | HUODWEBWPBHFEO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)CN=C(C2=CC=CC=C21)C3=CC=CC=C3 |
Computed by PubChem (NCBI)