CAS 2892064-99-0 appears in our catalog under these names: PARP10/15-IN-2, 99%, 99%, PARP10/15-IN-2, 98.92%. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg, 10mM/1mL, 5 mg.
6-[(2-fluorophenyl)methoxy]-2,3-dihydrophthalazine-1,4-dione (CAS 2892064-99-0) is a chemical compound with the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. IUPAC name: 6-[(2-fluorophenyl)methoxy]-2,3-dihydrophthalazine-1,4-dione. InChIKey: GJJIICZAOJXOEJ-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2O3 |
|---|---|
| Molecular weight | 286.26 g/mol |
| IUPAC name | 6-[(2-fluorophenyl)methoxy]-2,3-dihydrophthalazine-1,4-dione |
| InChIKey | GJJIICZAOJXOEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC3=C(C=C2)C(=O)NNC3=O)F |
Computed by PubChem (NCBI)