CAS 52663-70-4 appears in our catalog under these names: 2,2',3,3',4',5,6–Heptachlorobiphenyl, 2,2',3,3',4',5,6-Heptachlorobiphenyl, PCB No. 177 10 µg/mL in Isooctane, PCB 177, ROTI®Star, 5 mg, glass, PCB 177. Offered by: GLPBio, Biosynth, Dr. Ehrenstorfer, Roth, HPC Standards. Available pack sizes: 1ml, 5mg, 10mg, 25mg, 50mg, 10ml, 1x5mg.
1,2,4,5-tetrachloro-3-(2,3,4-trichlorophenyl)benzene (CAS 52663-70-4) is a chemical compound with the molecular formula C12H3Cl7 and a molecular weight of 395.3 g/mol. IUPAC name: 1,2,4,5-tetrachloro-3-(2,3,4-trichlorophenyl)benzene. InChIKey: CXOYNJAHPUASHN-UHFFFAOYSA-N.
| Molecular formula | C12H3Cl7 |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | 1,2,4,5-tetrachloro-3-(2,3,4-trichlorophenyl)benzene |
| InChIKey | CXOYNJAHPUASHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C2=C(C(=CC(=C2Cl)Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)