CAS 41411-64-7 appears in our catalog under these names: PCB No. 190 10 µg/mL in Isooctane, 2,3,3',4,4',5,6–Heptachlorobiphenyl, 2,3,3',4,4',5,6-Heptachlorobiphenyl, PCB 190, ROTI®Star, 5 mg, glass. Offered by: Dr. Ehrenstorfer, GLPBio, Biosynth, Roth. Available pack sizes: 10ml, 1ml, 5ml, 25ml, 50ml, 5mg.
1,2,3,4,5-pentachloro-6-(3,4-dichlorophenyl)benzene (CAS 41411-64-7) is a chemical compound with the molecular formula C12H3Cl7 and a molecular weight of 395.3 g/mol. IUPAC name: 1,2,3,4,5-pentachloro-6-(3,4-dichlorophenyl)benzene. InChIKey: TYEDCFVCFDKSBK-UHFFFAOYSA-N.
| Molecular formula | C12H3Cl7 |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | 1,2,3,4,5-pentachloro-6-(3,4-dichlorophenyl)benzene |
| InChIKey | TYEDCFVCFDKSBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)