CAS 1435467-38-1 appears in our catalog under these names: PF–06281355, PF-1355/ 99.77% (existing batch purity), PF 06281355, 6-(2,5-Dimethoxyphenyl)-3,4-dihydro-4-oxo-2-thioxo-1(2H)-pyrimidineacetamide, 98%, 98%, PF-1355, 99.80%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[6-(2,5-dimethoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-1-yl]acetamide (CAS 1435467-38-1) is a chemical compound with the molecular formula C14H15N3O4S and a molecular weight of 321.35 g/mol. IUPAC name: 2-[6-(2,5-dimethoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-1-yl]acetamide. InChIKey: LJBUZOGABRDGBR-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O4S |
|---|---|
| Molecular weight | 321.35 g/mol |
| IUPAC name | 2-[6-(2,5-dimethoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-1-yl]acetamide |
| InChIKey | LJBUZOGABRDGBR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=CC(=O)NC(=S)N2CC(=O)N |
Computed by PubChem (NCBI)