CAS 15923-42-9 appears in our catalog under these names: PNU 22394 hydrochloride/ 98.57% (existing batch purity), PNU 22394 hydrochloride, PNU 22394 hydrochloride, PNU 22394 hydrochloride, 97%, 97%, PNU-22394 (hydrochloride), 98.79%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
6-methyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole;hydrochloride (CAS 15923-42-9) is a chemical compound with the molecular formula C13H17ClN2 and a molecular weight of 236.74 g/mol. IUPAC name: 6-methyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole;hydrochloride. InChIKey: SAIGGEUWSYESTR-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | 6-methyl-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indole;hydrochloride |
| InChIKey | SAIGGEUWSYESTR-UHFFFAOYSA-N |
| SMILES | CN1C2=C(CCNCC2)C3=CC=CC=C31.Cl |
Computed by PubChem (NCBI)