CAS 2060031-21-0 appears in our catalog under these names: (2,5-Dimethyl-1-phenyl-1H-pyrrol-3-yl)methanamine hydrochloride, 95%, (2,5-Dimethyl-1-phenyl-1H-pyrrol-3-yl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2,5-dimethyl-1-phenylpyrrol-3-yl)methanamine;hydrochloride (CAS 2060031-21-0) is a chemical compound with the molecular formula C13H17ClN2 and a molecular weight of 236.74 g/mol. IUPAC name: (2,5-dimethyl-1-phenylpyrrol-3-yl)methanamine;hydrochloride. InChIKey: ZOINRZMZFNNEIS-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | (2,5-dimethyl-1-phenylpyrrol-3-yl)methanamine;hydrochloride |
| InChIKey | ZOINRZMZFNNEIS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC=C2)C)CN.Cl |
Computed by PubChem (NCBI)