Products 1246820-20-1
CAS 1246820-20-1 appears in our catalog under these names: Medetomidine-d3 Hydrochloride, >95% (HPLC), Medetomidine-d3 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
5-[2,2,2-trideuterio-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole;hydrochloride (CAS 1246820-20-1) is a chemical compound with the molecular formula C13H17ClN2 and a molecular weight of 239.76 g/mol. IUPAC name: 5-[2,2,2-trideuterio-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole;hydrochloride. InChIKey: VPNGEIHDPSLNMU-FJCVKDQNSA-N.
| Molecular formula | C13H17ClN2 |
|---|---|
| Molecular weight | 239.76 g/mol |
| IUPAC name | 5-[2,2,2-trideuterio-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole;hydrochloride |
| InChIKey | VPNGEIHDPSLNMU-FJCVKDQNSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=CC(=C1C)C)C2=CN=CN2.Cl |
Computed by PubChem (NCBI)