cas: 66893-81-0 — see every product listed under this CAS number, including other names
POBN 98% HPLC (CAS 66893-81-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A371116-100mg |
| cas | 66893-81-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 387.06 Pln | |
| Ambeed | 250mg | 581.75 Pln | |
| Ambeed | 1g | 1494.00 Pln |
| purity | 98% HPLC |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A371116 |
N-tert-butyl-1-(1-oxidopyridin-1-ium-4-yl)methanimine oxide (CAS 66893-81-0) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: N-tert-butyl-1-(1-oxidopyridin-1-ium-4-yl)methanimine oxide. InChIKey: RNRMWTCECDHNQU-WQLSENKSSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | N-tert-butyl-1-(1-oxidopyridin-1-ium-4-yl)methanimine oxide |
| InChIKey | RNRMWTCECDHNQU-WQLSENKSSA-N |
| SMILES | CC(C)(C)/[N+](=C/C1=CC=[N+](C=C1)[O-])/[O-] |
Computed by PubChem (NCBI)