cas: 3375-31-3 — see every product listed under this CAS number, including other names
Palladium(II) Acetate, >98.0%(T) (CAS 3375-31-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A1424-1G |
| cas | 3375-31-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 1162.29 Pln | |
| TCI | 5g | 5160.02 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
Palladium(2+) diacetate (CAS 3375-31-3) is a chemical compound with the molecular formula C4H6O4Pd and a molecular weight of 224.51 g/mol. IUPAC name: palladium(2+) diacetate. InChIKey: YJVFFLUZDVXJQI-UHFFFAOYSA-L.
| Molecular formula | C4H6O4Pd |
|---|---|
| Molecular weight | 224.51 g/mol |
| IUPAC name | palladium(2+) diacetate |
| InChIKey | YJVFFLUZDVXJQI-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Pd+2] |
Computed by PubChem (NCBI)