cas: 3375-31-3 — see every product listed under this CAS number, including other names
Palladium(II) acetate, 47.5% Pd (CAS 3375-31-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2g, 10g, 50g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 195180010 |
| cas | 3375-31-3 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 721.62 Pln | |
| Thermo Scientific (Acros) | 2g | 1447.70 Pln | |
| Thermo Scientific (Acros) | 10g | 6850.94 Pln | |
| Thermo Scientific (Acros) | 50g | 26985.06 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 47.5% |
Palladium(2+) diacetate (CAS 3375-31-3) is a chemical compound with the molecular formula C4H6O4Pd and a molecular weight of 224.51 g/mol. IUPAC name: palladium(2+) diacetate. InChIKey: YJVFFLUZDVXJQI-UHFFFAOYSA-L.
| Molecular formula | C4H6O4Pd |
|---|---|
| Molecular weight | 224.51 g/mol |
| IUPAC name | palladium(2+) diacetate |
| InChIKey | YJVFFLUZDVXJQI-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Pd+2] |
Computed by PubChem (NCBI)