cas: 3375-31-3 — see every product listed under this CAS number, including other names
Pd(OAc)2 (HPMC encapsulated) (CAS 3375-31-3) is a chemical reagent available from Chemat. Available pack sizes: 10each. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | R0303-10EACH |
| cas | 3375-31-3 |
| size | 10each |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 10each | 1368.82 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
Palladium(2+) diacetate (CAS 3375-31-3) is a chemical compound with the molecular formula C4H6O4Pd and a molecular weight of 224.51 g/mol. IUPAC name: palladium(2+) diacetate. InChIKey: YJVFFLUZDVXJQI-UHFFFAOYSA-L.
| Molecular formula | C4H6O4Pd |
|---|---|
| Molecular weight | 224.51 g/mol |
| IUPAC name | palladium(2+) diacetate |
| InChIKey | YJVFFLUZDVXJQI-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Pd+2] |
Computed by PubChem (NCBI)