CAS 3375-31-3 appears in our catalog under these names: Palladium acetate, 98%, Palladium(II) acetate, 98%, Palladium(II) Acetate, Palladium(II) acetate/ 99.95% (metals basis), Palladium (II) acetate. Offered by: Combi-blocks, TRC, Chemat, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 5g, 100g, 1g, 100mg, 250mg, 50mg, 2g.
Palladium(2+) diacetate (CAS 3375-31-3) is a chemical compound with the molecular formula C4H6O4Pd and a molecular weight of 224.51 g/mol. IUPAC name: palladium(2+) diacetate. InChIKey: YJVFFLUZDVXJQI-UHFFFAOYSA-L.
| Molecular formula | C4H6O4Pd |
|---|---|
| Molecular weight | 224.51 g/mol |
| IUPAC name | palladium(2+) diacetate |
| InChIKey | YJVFFLUZDVXJQI-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Pd+2] |
Computed by PubChem (NCBI)