cas: 105812-81-5 — see every product listed under this CAS number, including other names
Paroxol 95% (CAS 105812-81-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A632262-1g |
| cas | 105812-81-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 181.25 Pln | |
| Ambeed | 25g | 298.06 Pln | |
| Ambeed | 100g | 904.38 Pln | |
| Ambeed | 500g | 2984.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A632262 |
[(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methanol (CAS 105812-81-5) is a chemical compound with the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. IUPAC name: [(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methanol. InChIKey: CXRHUYYZISIIMT-AAEUAGOBSA-N.
| Molecular formula | C13H18FNO |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | [(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methanol |
| InChIKey | CXRHUYYZISIIMT-AAEUAGOBSA-N |
| SMILES | CN1CC[C@H]([C@@H](C1)CO)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)