cas: 5986-55-0 — see every product listed under this CAS number, including other names
Patchouli Alcohol (CAS 5986-55-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25mg, 50mg, 20mg, 10mM (in 1ml dmso), 10mg, 5mg, 0,1g. Offered by: TRC, GLPBio, Biosynth, HPC Standards.
| brand | TRC |
|---|---|
| catalog number | TRC-P206200-250MG |
| cas | 5986-55-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| TRC | 250mg | price on request | |
| TRC | 25mg | price on request | |
| TRC | 50mg | price on request | |
| GLPBio | 20mg | 831.06 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 578.32 Pln | |
| GLPBio | 10mg | 564.28 Pln | |
| GLPBio | 25mg | 709.37 Pln | |
| GLPBio | 5mg | 522.15 Pln | |
| Biosynth | 0,1g | price on request | |
| Biosynth | 0,25g | price on request | |
| Biosynth | 0,5g | price on request | |
| Biosynth | 1g | price on request | |
| Biosynth | 2g | price on request | |
| HPC Standards | 1x10mg | 818.89 Pln | |
| Fluorochem | 100mg | 909.07 Pln | |
| Fluorochem | 250mg | 1486.99 Pln | |
| Fluorochem | 1g | 3715.38 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Patchouli alcohol is a carbotricyclic compound and sesquiterpenoid tertiary alcohol that is tricyclo[5.3.1.03,8]undecan-3-ol which is substituted at positions 2, 2, 6 and 8 by methyl groups (the 1R,3R,6S,7S,8S-diastereoisomer). It is a sesquiterpenoid, a tertiary alcohol and a carbotricyclic compound.
Source: ChEBI
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | (1R,3R,6S,7S,8S)-2,2,6,8-tetramethyltricyclo[5.3.1.03,8]undecan-3-ol |
| InChIKey | GGHMUJBZYLPWFD-CUZKYEQNSA-N |
| SMILES | C[C@H]1CC[C@@]2([C@@]3([C@H]1C[C@H](C2(C)C)CC3)C)O |
Computed by PubChem (NCBI)