Phenanthrene-2,7-diamine, 98%
cas: 62245-46-9 — see every product listed under this CAS number, including other names
Phenanthrene-2,7-diamine, 98% (CAS 62245-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1215386-100mg |
| cas | 62245-46-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1160.25 Pln | |
| Ambeed | 250mg | 1939.00 Pln | |
| Ambeed | 1g | 5359.94 Pln | |
| Chemat | 100mg | 770.00 Pln | |
| Chemat | 250mg | 1278.80 Pln | |
| Chemat | 1g | 3904.40 Pln | |
| BLDpharm | 100mg | 1247.36 Pln | |
| BLDpharm | 250mg | 2085.96 Pln | |
| BLDpharm | 1g | 5773.55 Pln | |
| Fluorochem | 100mg | 1200.64 Pln | |
| Fluorochem | 250mg | 1992.02 Pln | |
| Fluorochem | 1g | 5490.79 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Phenanthrene-2,7-diamine (CAS 62245-46-9) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: phenanthrene-2,7-diamine. InChIKey: QJZDTUSIYGXUJR-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | phenanthrene-2,7-diamine |
| InChIKey | QJZDTUSIYGXUJR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C=CC(=C3)N)C=C1N |
Computed by PubChem (NCBI)