cas: 50882-29-6 — see every product listed under this CAS number, including other names
Phenyl (4-bromophenyl)carbamate, 95+% (CAS 50882-29-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A182532-5g |
| cas | 50882-29-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10512.04 Pln | |
| AmBeed | 250mg | 3539.83 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Phenyl N-(4-bromophenyl)carbamate (CAS 50882-29-6) is a chemical compound with the molecular formula C13H10BrNO2 and a molecular weight of 292.13 g/mol. IUPAC name: phenyl N-(4-bromophenyl)carbamate. InChIKey: DFVROMJTBLOOGY-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO2 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | phenyl N-(4-bromophenyl)carbamate |
| InChIKey | DFVROMJTBLOOGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)