cas: 50882-29-6 — see every product listed under this CAS number, including other names
Phenyl (4-bromophenyl)carbamate (CAS 50882-29-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E2FO-100mg |
| cas | 50882-29-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 1854.80 Pln | |
| Chemat | 5g | 5426.00 Pln |
| delivery time | 3 weeks |
|---|
Phenyl N-(4-bromophenyl)carbamate (CAS 50882-29-6) is a chemical compound with the molecular formula C13H10BrNO2 and a molecular weight of 292.13 g/mol. IUPAC name: phenyl N-(4-bromophenyl)carbamate. InChIKey: DFVROMJTBLOOGY-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO2 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | phenyl N-(4-bromophenyl)carbamate |
| InChIKey | DFVROMJTBLOOGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)