cas: 100390-48-5 — see every product listed under this CAS number, including other names
Phenyl-pyrrolidin-1-yl-acetic acid, 98% (CAS 100390-48-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F028346-250MG |
| cas | 100390-48-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1757.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-phenyl-2-pyrrolidin-1-ylacetic acid (CAS 100390-48-5) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 2-phenyl-2-pyrrolidin-1-ylacetic acid. InChIKey: HYOZIYFGQLGJFY-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 2-phenyl-2-pyrrolidin-1-ylacetic acid |
| InChIKey | HYOZIYFGQLGJFY-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)