cas: 180609-56-7 — see every product listed under this CAS number, including other names
Piperidine-1,2-dicarboxylic acid 1-benzyl ester 2-methyl ester, 95% (CAS 180609-56-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F088222-10G |
| cas | 180609-56-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 154.13 Pln | |
| Fluorochem | 25g | 289.50 Pln | |
| Fluorochem | 100g | 825.77 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-O-benzyl 2-O-methyl piperidine-1,2-dicarboxylate (CAS 180609-56-7) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl piperidine-1,2-dicarboxylate. InChIKey: PKYPKDMELOKLKL-UHFFFAOYSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl piperidine-1,2-dicarboxylate |
| InChIKey | PKYPKDMELOKLKL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)