cas: 91396-88-2 — see every product listed under this CAS number, including other names
PluriSIn 1 98% (CAS 91396-88-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A230785-1mg |
| cas | 91396-88-2 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 192.38 Pln | |
| Ambeed | 5mg | 214.62 Pln | |
| Ambeed | 10mg | 292.50 Pln | |
| Ambeed | 50mg | 592.88 Pln | |
| Ambeed | 100mg | 826.50 Pln | |
| Ambeed | 250mg | 976.69 Pln | |
| Ambeed | 1g | 1160.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A230785 |
N'-phenylpyridine-4-carbohydrazide (CAS 91396-88-2) is a chemical compound with the molecular formula C12H11N3O and a molecular weight of 213.23 g/mol. IUPAC name: N'-phenylpyridine-4-carbohydrazide. InChIKey: HUDWXDLBWRHCKO-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | N'-phenylpyridine-4-carbohydrazide |
| InChIKey | HUDWXDLBWRHCKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NNC(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)