CAS 91396-88-2 appears in our catalog under these names: NSC 14613, PluriSIn 1/ 99.59% (existing batch purity), PluriSIn #1 (NSC 14613), PluriSln 1, PluriSIn 1, >98.0%(HPLC). Offered by: TRC, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 200mg, 500mg, 10mM (in 1ml dmso).
N'-phenylpyridine-4-carbohydrazide (CAS 91396-88-2) is a chemical compound with the molecular formula C12H11N3O and a molecular weight of 213.23 g/mol. IUPAC name: N'-phenylpyridine-4-carbohydrazide. InChIKey: HUDWXDLBWRHCKO-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | N'-phenylpyridine-4-carbohydrazide |
| InChIKey | HUDWXDLBWRHCKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NNC(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)