cas: 91396-88-2 — see every product listed under this CAS number, including other names
PluriSln 1, 98%, 98% (CAS 91396-88-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 50mg, 100mg, 250mg, 1g, 1mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GU6L-5mg |
| cas | 91396-88-2 |
| size | 5mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 150.80 Pln | |
| Chemat | 10mg | 165.20 Pln | |
| Chemat | 50mg | 405.20 Pln | |
| Chemat | 100mg | 630.80 Pln | |
| Chemat | 250mg | 918.80 Pln | |
| Chemat | 1g | 1946.00 Pln | |
| Chemat | 1mg | 98.00 Pln | |
| Chemat | 5g | 7926.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N'-phenylpyridine-4-carbohydrazide (CAS 91396-88-2) is a chemical compound with the molecular formula C12H11N3O and a molecular weight of 213.23 g/mol. IUPAC name: N'-phenylpyridine-4-carbohydrazide. InChIKey: HUDWXDLBWRHCKO-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | N'-phenylpyridine-4-carbohydrazide |
| InChIKey | HUDWXDLBWRHCKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NNC(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)