cas: 1428629-71-3 — see every product listed under this CAS number, including other names
Propargyl-PEG3-NHS ester, 97%, 97% (CAS 1428629-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HWPS-100mg |
| cas | 1428629-71-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 837.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-(2-prop-2-ynoxyethoxy)ethoxy]propanoate (CAS 1428629-71-3) is a chemical compound with the molecular formula C14H19NO7 and a molecular weight of 313.30 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-(2-prop-2-ynoxyethoxy)ethoxy]propanoate. InChIKey: YDRPXORAOIYIGV-UHFFFAOYSA-N.
| Molecular formula | C14H19NO7 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(2-prop-2-ynoxyethoxy)ethoxy]propanoate |
| InChIKey | YDRPXORAOIYIGV-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)