CAS 1142198-09-1 is the registry number for Methyl 3,4,5-triethoxy-2-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3,4,5-triethoxy-2-nitrobenzoate (CAS 1142198-09-1) is a chemical compound with the molecular formula C14H19NO7 and a molecular weight of 313.30 g/mol. IUPAC name: methyl 3,4,5-triethoxy-2-nitrobenzoate. InChIKey: JTOUBRGMBGEYAA-UHFFFAOYSA-N.
| Molecular formula | C14H19NO7 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | methyl 3,4,5-triethoxy-2-nitrobenzoate |
| InChIKey | JTOUBRGMBGEYAA-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C(=C1)C(=O)OC)[N+](=O)[O-])OCC)OCC |
Computed by PubChem (NCBI)